CAS 83457-06-1
:3-bromo-2-methylfuran
Description:
3-Bromo-2-methylfuran is an organic compound characterized by its furan ring, which is a five-membered aromatic heterocycle containing one oxygen atom. The presence of a bromine atom at the 3-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid and has a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its non-polar characteristics. The bromine substituent enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. 3-Bromo-2-methylfuran can serve as an intermediate in the synthesis of more complex organic molecules, particularly in the fields of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as brominated compounds can be hazardous. Overall, 3-bromo-2-methylfuran is a valuable compound in organic synthesis, with applications in research and industry.
Formula:C5H5BrO
InChI:InChI=1/C5H5BrO/c1-4-5(6)2-3-7-4/h2-3H,1H3
SMILES:Cc1c(cco1)Br
Synonyms:- Furan, 3-Bromo-2-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Bromo-2-methylfuran
CAS:<p>3-Bromo-2-methylfuran</p>Purity:95%Color and Shape:Pale Yellow LiquidMolecular weight:161.00g/mol3-Bromo-2-methyl-furan
CAS:<p>3-Bromo-2-methyl-furan is a substituted quinoline. It is a synthetic reagent that can be used for the synthesis of bromofuran derivatives. The methyl group on the 3rd carbon atom in 3-bromo-2-methyl-furan is a substituent that can be exchanged with other substituents, such as alkylation, to produce a variety of products.<br>3-Bromo-2-methyl furan has been shown to be able to extract metal ions from their complexes and form stable complexes. This property makes it an ideal reagent for metalation reactions.</p>Formula:C5H5BrOPurity:Min. 95%Molecular weight:161 g/mol


