CAS 83459-29-4
:3,4-Diethoxybenzyl alcohol
Description:
3,4-Diethoxybenzyl alcohol is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two ethoxy groups and a hydroxymethyl group. The presence of the hydroxymethyl group (-CH2OH) indicates that it is an alcohol, which contributes to its solubility in polar solvents. The ethoxy groups (-OCH2CH3) enhance the compound's hydrophobic characteristics while also providing some degree of polarity due to the ether functionality. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It has applications in organic synthesis, particularly as an intermediate in the production of pharmaceuticals and other fine chemicals. The compound's reactivity is influenced by the functional groups present, allowing for various chemical transformations, such as oxidation or esterification. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, 3,4-Diethoxybenzyl alcohol is a versatile compound with notable properties that make it useful in various chemical applications.
Formula:C11H16O3
InChI:InChI=1/C11H16O3/c1-3-13-10-6-5-9(8-12)7-11(10)14-4-2/h5-7,12H,3-4,8H2,1-2H3
SMILES:CCOc1ccc(cc1OCC)CO
Synonyms:- (3,4-Diethoxyphenyl)methanol
- Benzenemethanol, 3,4-Diethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-Diethoxybenzylalcohol
CAS:<p>3,4-Diethoxybenzylalcohol is a metabolite produced by the fungus Ustilago maydis. It has been shown to have pleiotropic effects on the metabolism of the organism. 3,4-Diethoxybenzylalcohol is involved in lignin biosynthesis and bond cleavage reactions. In addition to functioning as an intermediate in the pentose phosphate pathway, it is involved in the nature of the basidiomycete cell wall and also plays a role in carbon source utilization.</p>Formula:C11H16O3Purity:Min. 95%Color and Shape:PowderMolecular weight:196.24 g/mol




