CAS 83459-41-0
:Ginsenoside Ra<sub>1</sub>
Description:
Ginsenoside Ra1 is a natural glycoside compound primarily found in ginseng, a plant renowned for its medicinal properties. It belongs to the class of saponins, which are characterized by their amphipathic nature, allowing them to interact with both water and lipids. Ginsenoside Ra1 is known for its potential pharmacological effects, including anti-inflammatory, antioxidant, and neuroprotective properties. It is believed to contribute to the overall health benefits associated with ginseng consumption, such as enhancing cognitive function and supporting immune response. The compound typically exhibits low toxicity and is considered safe for consumption in moderate amounts. Its structure includes a steroid-like backbone with multiple sugar moieties, which influence its solubility and bioactivity. Research continues to explore the mechanisms through which ginsenoside Ra1 exerts its effects, making it a subject of interest in both traditional medicine and modern pharmacology. Overall, ginsenoside Ra1 exemplifies the complex interplay between natural compounds and human health, highlighting the importance of phytochemicals in therapeutic applications.
Formula:C58H98O26
InChI:InChI=1S/C58H98O26/c1-24(2)10-9-14-58(8,84-52-47(74)42(69)39(66)30(81-52)22-76-49-45(72)40(67)31(23-77-49)80-50-44(71)36(63)27(62)21-75-50)25-11-16-57(7)35(25)26(61)18-33-55(5)15-13-34(54(3,4)32(55)12-17-56(33,57)6)82-53-48(43(70)38(65)29(20-60)79-53)83-51-46(73)41(68)37(64)28(19-59)78-51/h10,25-53,59-74H,9,11-23H2,1-8H3/t25-,26+,27+,28+,29+,30+,31-,32-,33+,34-,35-,36-,37+,38+,39+,40-,41-,42-,43-,44+,45+,46+,47+,48+,49+,50-,51-,52-,53-,55-,56+,57+,58-/m0/s1
InChI key:InChIKey=KVMXBSSOCCPAOR-WWJNHZDPSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@@]([C@@](O[C@@H]4O[C@H](CO[C@H]5[C@H](O)[C@@H](O)[C@@H](O[C@H]6[C@H](O)[C@@H](O)[C@H](O)CO6)CO5)[C@@H](O)[C@H](O)[C@H]4O)(CCC=C(C)C)C)(CC3)[H])([C@H](O)C[C@@]1([C@]7(C)[C@@](CC2)(C(C)(C)[C@@H](O[C@H]8[C@H](O[C@@H]9O[C@H](CO)[C@@H](O)[C@H](O)[C@H]9O)[C@@H](O)[C@H](O)[C@@H](CO)O8)CC7)[H])[H])[H]
Synonyms:- (3β,12β)-12-Hydroxy-20-[(O-β-D-xylopyranosyl-(1→4)-O-α-L-arabinopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
- β-D-Glucopyranoside, (3β,12β)-12-hydroxy-20-[(O-β-D-xylopyranosyl-(1→4)-O-α-L-arabinopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-
- Dammarane, β-D-glucopyranoside deriv.
- Ginsenoside Ra1
- (3beta,12beta)-12-Hydroxy-20-[(O-beta-D-xylopyranosyl-(1-4)-O-alpha-L-arabinopyranosyl-(1-6)-beta-D-glucopyranosyl)oxy]dammar-24-en-3-yl 2-O-beta-D-glucopyranosyl-beta-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ginsenoside Ra1
CAS:<p>Ginsenoside Ra1 is a component from ginseng.</p>Formula:C58H98O26Purity:97.44%Color and Shape:SolidMolecular weight:1211.38Ginsenoside Ra1
CAS:<p>Ginsenoside Ra1 is a naturally occurring saponin, which is derived from the roots of Panax ginseng. This compound falls under the category of ginsenosides, which are a class of triterpene glycosides notable for their diverse pharmacological effects. Ginsenoside Ra1 is sourced specifically from the root of the ginseng plant, a widely studied herb in traditional medicine, and is extracted using advanced chromatographic techniques to ensure purity.</p>Formula:C58H98O26Purity:Min. 95%Molecular weight:1,211.4 g/mol






