CAS 83462-45-7
:(1R,1'R)-1,1'-ethane-1,2-diylbis-4,5,6,7-tetrahydro-1H-indene - dichlorotitanium (1:1)
Description:
The chemical substance known as "(1R,1'R)-1,1'-ethane-1,2-diylbis-4,5,6,7-tetrahydro-1H-indene - dichlorotitanium (1:1)" with CAS number 83462-45-7 is a coordination compound featuring a titanium center coordinated with a bidentate ligand derived from a substituted indene structure. This compound typically exhibits characteristics associated with transition metal complexes, such as variable oxidation states and the ability to participate in catalytic reactions. The presence of dichlorotitanium suggests that it may have applications in organometallic chemistry, particularly in catalysis or polymerization processes. The stereochemistry indicated by the (1R,1'R) notation implies specific spatial arrangements of the substituents, which can influence the compound's reactivity and interaction with other molecules. Additionally, the tetrahydroindene moiety contributes to the compound's overall stability and solubility properties. As with many organometallic compounds, safety precautions should be observed due to potential toxicity and reactivity, particularly in the presence of moisture or air.
Formula:C20H26Cl2Ti
InChI:InChI=1/C20H26.2ClH.Ti/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;;;/h9-12,17-18H,1-8,13-14H2;2*1H;/q;;;+2/p-2/t17-,18-;;;/m0.../s1/rC20H26.Cl2Ti/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;1-3-2/h9-12,17-18H,1-8,13-14H2;/t17-,18-;/m0./s1
SMILES:C1CCC2=C(C1)C=CC2CCC1C=CC2=C1CCCC2.Cl.Cl.[Ti]
Synonyms:- 83462-45-7
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.