CAS 83462-67-3
:(3R,4S,5R,6R)-3,4,5-tribenzyloxy-2-(benzyloxymethyl)-6-methoxy-tetrahydropyran
Description:
The chemical substance known as "(3R,4S,5R,6R)-3,4,5-tribenzyloxy-2-(benzyloxymethyl)-6-methoxy-tetrahydropyran," with the CAS number 83462-67-3, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple benzyloxy substituents, indicating the presence of benzyl groups attached to oxygen atoms, which contribute to its reactivity and solubility properties. The specific stereochemistry denoted by the (3R,4S,5R,6R) configuration suggests that it has defined spatial arrangements of its substituents, which can significantly influence its biological activity and interactions. The methoxy group further enhances its chemical properties, potentially affecting its polarity and reactivity. Such compounds are often of interest in organic synthesis and medicinal chemistry due to their potential applications in drug development and as intermediates in the synthesis of more complex molecules. Overall, the structural features of this compound suggest it may exhibit unique chemical behavior and biological activity, warranting further investigation.
Formula:C35H38O6
InChI:InChI=1/C35H38O6/c1-36-35-34(40-25-30-20-12-5-13-21-30)33(39-24-29-18-10-4-11-19-29)32(38-23-28-16-8-3-9-17-28)31(41-35)26-37-22-27-14-6-2-7-15-27/h2-21,31-35H,22-26H2,1H3/t31?,32-,33+,34-,35-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 2,3,4,6-tetra-O-benzyl-D-mannopyranoside
CAS:Methyl 2,3,4,6-tetra-O-benzyl-D-mannopyranoside is a benzylated sugar that has been glycosidically linked to an amino acid. This product has been shown to be a contaminant in the synthesis of other compounds and can be used as a chloride or benzylating reagent. It is used in the preparation of glycosyl halides and condensations. Methyl 2,3,4,6-tetra-O-benzyl-D-mannopyranoside is also used in the synthesis of natural products such as flavones and alkaloids.Formula:C35H38O6Purity:Min. 95%Molecular weight:554.67 g/mol

