CAS 83467-28-1

3,5-Dimethyl-4-(2-bromoethyl)-1H-pyrazole

Description:

3,5-Dimethyl-4-(2-bromoethyl)-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two adjacent nitrogen atoms. This specific compound features two methyl groups at the 3 and 5 positions of the pyrazole ring, contributing to its hydrophobic characteristics and potentially influencing its reactivity and solubility. The presence of a bromoethyl group at the 4 position introduces a halogen, which can enhance the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. The compound is typically a solid at room temperature and may exhibit moderate to low solubility in water, depending on the specific conditions. Its unique structure allows it to participate in diverse chemical applications, including medicinal chemistry and agrochemical development. Safety data should be consulted for handling, as the presence of bromine can pose health risks. Overall, 3,5-Dimethyl-4-(2-bromoethyl)-1H-pyrazole is a versatile compound with potential applications in various fields of chemistry.

Formula: C₇H₁₁BrN₂

InChI: InChI=1/C7H11BrN2/c1-5-7(3-4-8)6(2)10-9-5/h3-4H2,1-2H3,(H,9,10)

SMILES: Cc1c(CCBr)c(C)n[nH]1

Synonyms:

• 4-(2-bromoethyl)-3,5-dimethyl-1H-pyrazole

4-(2-Bromoethyl)-3,5-dimethyl-1H-pyrazole

CAS: 83467-28-1

Formula: C₇H₁₁BrN₂

Molecular weight: 203.0796

Ref: IN-DA004VBD

4-(2-Bromoethyl)-3,5-dimethyl-1H-pyrazole

CAS: 83467-28-1

4-(2-Bromoethyl)-3,5-dimethyl-1H-pyrazole

Purity: ≥95%

Color and Shape: White Powder

Molecular weight: 203.08g/mol

Ref: 54-OR7065

4-(2-Bromo-ethyl)-3,5-dimethyl-1H-pyrazole

CAS: 83467-28-1

Formula: C₇H₁₁BrN₂

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 203.083

Ref: 10-F041909