CAS 83467-29-2

3,5-Dimethyl-4-(2-iodoethyl)-1H-pyrazole

Description:

3,5-Dimethyl-4-(2-iodoethyl)-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of two methyl groups at the 3 and 5 positions contributes to its hydrophobic character, while the 4-position features a 2-iodoethyl substituent, which introduces a halogen and enhances its reactivity. This compound is typically synthesized through specific organic reactions involving pyrazole derivatives and iodoalkylation processes. It may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The iodine atom can serve as a potential site for further chemical modifications or reactions, such as nucleophilic substitutions. Additionally, the compound's structure suggests potential applications in agrochemicals or as a building block in organic synthesis. As with many halogenated compounds, considerations regarding its environmental impact and safety profile are essential during handling and application.

Formula: C₇H₁₁IN₂

InChI: InChI=1/C7H11IN2/c1-5-7(3-4-8)6(2)10-9-5/h3-4H2,1-2H3,(H,9,10)

SMILES: Cc1c(CCI)c(C)n[nH]1

Synonyms:

• 4-(2-iodoethyl)-3,5-dimethyl-1H-pyrazole

3,5-Dimethyl-4-(2-iodoethyl)-1H-pyrazole

CAS: 83467-29-2

3,5-Dimethyl-4-(2-iodoethyl)-1H-pyrazole

Purity: ≥95%

Molecular weight: 250.08g/mol

Ref: 54-OR7081