CAS 83467-34-9

3,5-Dimethyl-4-(2-hydroxyethyl)-isoxazole

Description:

3,5-Dimethyl-4-(2-hydroxyethyl)-isoxazole, with the CAS number 83467-34-9, is a heterocyclic organic compound characterized by its isoxazole ring, which is a five-membered ring containing both nitrogen and oxygen atoms. This compound features two methyl groups at the 3 and 5 positions of the isoxazole ring, contributing to its hydrophobic character, while the 4-position is substituted with a 2-hydroxyethyl group, which introduces hydrophilicity and enhances solubility in polar solvents. The presence of the hydroxyl group also suggests potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. 3,5-Dimethyl-4-(2-hydroxyethyl)-isoxazole may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of compounds with specific biological targets. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental conditions such as pH and temperature.

Formula: C₇H₁₁NO₂

InChI: InChI=1/C7H11NO2/c1-5-7(3-4-9)6(2)10-8-5/h9H,3-4H2,1-2H3

SMILES: Cc1c(CCO)c(C)on1

Synonyms:

• 2-(3,5-Dimethyl-1,2-Oxazol-4-Yl)Ethanol

3,5-Dimethyl-4-(2-hydroxyethyl)isoxazole

CAS: 83467-34-9

Formula: C₇H₁₁NO₂

Purity: 95%

Molecular weight: 141.1677

Ref: IN-DA0053ZG

2-(3,5-Dimethylisoxazol-4-Yl)Ethanol

CAS: 83467-34-9

2-(3,5-Dimethylisoxazol-4-Yl)Ethanol

Purity: 99%

Molecular weight: 141.17g/mol

Ref: 54-OR1009717

2-(3,5-dimethylisoxazol-4-yl)ethanol

CAS: 83467-34-9

Formula: C₇H₁₁NO₂

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 141.17

Ref: 10-F309648