CAS 83467-47-4

6-fluoro-2-(5-nitrofuran-2-yl)-1H-benzimidazole

Description:

6-Fluoro-2-(5-nitrofuran-2-yl)-1H-benzimidazole is a chemical compound characterized by its unique structural features, which include a benzimidazole core substituted with a fluoro group and a nitrofuran moiety. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity. The nitrofuran group is known for its potential pharmacological properties, often associated with antimicrobial and antiparasitic activities. This compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the nitro group, which can affect its reactivity and interaction with biological targets. Additionally, the benzimidazole framework is commonly found in various pharmaceuticals, contributing to the compound's potential therapeutic applications. Overall, 6-fluoro-2-(5-nitrofuran-2-yl)-1H-benzimidazole represents a class of compounds that may be of interest in medicinal chemistry and drug development, particularly in the search for new agents with specific biological activities.

Formula: C₁₁H₆FN₃O₃

InChI: InChI=1/C11H6FN3O3/c12-6-1-2-7-8(5-6)14-11(13-7)9-3-4-10(18-9)15(16)17/h1-5H,(H,13,14)

SMILES: c1cc2c(cc1F)nc(c1ccc(N(=O)=O)o1)[nH]2