CAS 83468-83-1
:Boc-L-His(Bom)-OH
Description:
Boc-L-His(Bom)-OH, with the CAS number 83468-83-1, is a protected derivative of the amino acid histidine. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amino functionality, while the "Bom" (benzyl oxycarbonyl) group protects the side chain imidazole nitrogen. This compound is typically used in peptide synthesis, allowing for selective reactions without interfering with the protected functional groups. It is characterized by its stability under standard laboratory conditions, making it suitable for various synthetic applications. The presence of the Boc and Bom groups enhances its solubility in organic solvents, facilitating purification processes such as chromatography. Additionally, Boc-L-His(Bom)-OH can be deprotected under mild acidic conditions, allowing for the release of the free amino acid for further reactions. Its structural features contribute to its utility in the synthesis of biologically active peptides and pharmaceuticals, particularly in the field of medicinal chemistry. Overall, this compound exemplifies the importance of protecting groups in organic synthesis, enabling the construction of complex molecular architectures.
Formula:C19H25N3O5
InChI:InChI=1/C19H25N3O5/c1-19(2,3)27-18(25)21-16(17(23)24)9-15-10-20-12-22(15)13-26-11-14-7-5-4-6-8-14/h4-8,10,12,16H,9,11,13H2,1-3H3,(H,21,25)(H,23,24)/t16-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](Cc1cncn1COCc1ccccc1)C(=O)O)O
Synonyms:- Boc-His(Bom)-OH
- N(alpha)-boc-N(im)-benzyloxymethoxy-L-histidine monohydr
- 3-[(benzyloxy)methyl]-N-(tert-butoxycarbonyl)-L-histidine
- N-Boc-N'-benzyloxymethyl-L-histidine
- N-tert-Butyloxycarbonyl-N'-benzyloxymethyl-L-histidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
