CymitQuimica logo

CAS 83473-61-4

:

N-(4-amino-2-methylphenyl)-N~2~,N~2~-dimethylglycinamide

Description:
N-(4-amino-2-methylphenyl)-N',N'-dimethylglycinamide, with the CAS number 83473-61-4, is a chemical compound that belongs to the class of amino acid derivatives. It features a glycinamide backbone substituted with a 4-amino-2-methylphenyl group and two dimethyl groups. This structure contributes to its unique properties, including potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. The dimethyl groups can enhance lipophilicity, potentially affecting its pharmacokinetics if used in medicinal chemistry. The compound may exhibit various interactions with biological targets, making it of interest in pharmaceutical research. Its synthesis typically involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and chromatography. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards. Overall, this compound's unique structure positions it as a candidate for further investigation in various chemical and biological applications.
Formula:C11H17N3O
InChI:InChI=1/C11H17N3O/c1-8-6-9(12)4-5-10(8)13-11(15)7-14(2)3/h4-6H,7,12H2,1-3H3,(H,13,15)
SMILES:Cc1cc(ccc1NC(=O)CN(C)C)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.