CAS 83480-65-3
:Ginsenoside Y
Description:
Ginsenoside Y, with the CAS number 83480-65-3, is a triterpenoid saponin primarily derived from Panax ginseng, a plant known for its medicinal properties. This compound is part of a larger class of ginsenosides, which are believed to contribute to the pharmacological effects of ginseng. Ginsenoside Y is characterized by its complex molecular structure, which includes a steroid-like backbone with various sugar moieties attached, influencing its solubility and biological activity. It exhibits a range of potential health benefits, including anti-inflammatory, antioxidant, and neuroprotective effects. Research suggests that ginsenoside Y may play a role in modulating immune responses and enhancing cognitive function. Its bioactivity is attributed to its ability to interact with various cellular pathways, making it a subject of interest in pharmacological studies. However, further research is needed to fully elucidate its mechanisms of action and therapeutic potential. As with many natural compounds, the efficacy and safety of ginsenoside Y can vary based on dosage and individual response.
Formula:C41H70O12
InChI:InChI=1S/C41H70O12/c1-21(2)10-9-14-41(8,53-36-34(49)32(47)31(46)25(52-36)20-51-35-33(48)30(45)24(43)19-50-35)22-11-16-40(7)29(22)23(42)18-27-38(5)15-13-28(44)37(3,4)26(38)12-17-39(27,40)6/h10,22-36,42-49H,9,11-20H2,1-8H3/t22-,23+,24-,25+,26-,27+,28-,29-,30-,31+,32-,33+,34+,35-,36-,38-,39+,40+,41-/m0/s1
InChI key:InChIKey=YNBYFOIDLBTOMW-QHNUHGIDSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O)CC3)[H])(C[C@@H](O)[C@]4([C@@]2(C)CC[C@@]4([C@@](O[C@@H]5O[C@H](CO[C@H]6[C@H](O)[C@@H](O)[C@@H](O)CO6)[C@@H](O)[C@H](O)[C@H]5O)(CCC=C(C)C)C)[H])[H])[H]
Synonyms:- Ginsenoside Y
- 20-O-[α-L-Arabinopyranosyl(1→6)-β-D-glucopyranosyl]-20(S)-protopanaxadiol
- Dammarane, β-D-glucopyranoside deriv.
- β-D-Glucopyranoside, (3β,12β)-3,12-dihydroxydammar-24-en-20-yl 6-O-α-L-arabinopyranosyl-
- (3β,12β)-3,12-Dihydroxydammar-24-en-20-yl 6-O-α-L-arabinopyranosyl-β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ginsenoside C-Y
CAS:Ginsenoside C-Y, a natural antioxidant, exhibits antiphotoaging and antimelanogenesis properties.Formula:C41H70O12Color and Shape:SolidMolecular weight:754.999Ginsenoside C-Y
CAS:Ginsenoside C-Y is an analog of ginsenosides, a group of compounds found in Chinese medicinal herbs. It has been shown to exhibit potent anticancer activity against various types of cancer cells by inducing apoptosis, or programmed cell death. Ginsenoside C-Y acts as an inhibitor of kinases and other proteins involved in tumor growth and progression, making it a promising candidate for cancer therapy. This compound has also been found in human urine, indicating its potential use as a biomarker for cancer diagnosis and monitoring. Overall, Ginsenoside C-Y holds great promise as a natural anticancer agent with significant therapeutic potential.Formula:C41H70O12Purity:Min. 95%Molecular weight:755 g/mol


