CAS 83481-45-2
:(2S)-2-[[(2S)-6-amino-2-[[2-[[(2R)-2-[[(2S)-2-[[(2S)-1-[2-[[(2R)-2-[[(5S)-5-[(2-aminoacetyl)amino]-8-guanidino-4-oxo-2-(sulfanylmethyl)octanoyl]amino]-3-sulfanyl-propanoyl]amino]-3-(3H-imidazol-4-yl)propanoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]-
Description:
The chemical substance with the name provided is a complex peptide, characterized by its intricate structure that includes multiple amino acid residues and functional groups. It features a series of chiral centers, indicating that it exists in specific stereoisomeric forms, which can significantly influence its biological activity and interactions. The presence of amino groups suggests potential for hydrogen bonding and reactivity, while the guanidino group may contribute to its basicity and ability to participate in various biochemical processes. Additionally, the inclusion of a sulfanylmethyl group indicates potential for redox reactions or interactions with other thiol-containing compounds. This compound is likely to be involved in biological systems, possibly as a peptide hormone or signaling molecule, given its structural complexity. Its CAS number, 83481-45-2, allows for precise identification in chemical databases, facilitating research and application in fields such as biochemistry and pharmacology. Overall, the substance's characteristics suggest a significant role in biological functions, potentially influencing metabolic pathways or cellular signaling.
Formula:C59H93N21O17S4
InChI:InChI=1/C59H93N21O17S4/c1-29(70-57(96)43-8-5-15-80(43)58(97)38(18-32-21-66-28-69-32)75-56(95)42(27-101)79-50(89)31(24-98)17-44(83)34(71-46(85)20-61)7-4-14-67-59(64)65)49(88)78-41(26-100)51(90)68-22-47(86)72-35(6-2-3-13-60)52(91)74-37(19-45(62)84)54(93)73-36(16-30-9-11-33(82)12-10-30)53(92)76-39(23-81)55(94)77-40(25-99)48(63)87/h9-12,21,28-29,31,34-43,81-82,98-101H,2-8,13-20,22-27,60-61H2,1H3,(H2,62,84)(H2,63,87)(H,66,69)(H,68,90)(H,70,96)(H,71,85)(H,72,86)(H,73,93)(H,74,91)(H,75,95)(H,76,92)(H,77,94)(H,78,88)(H,79,89)(H4,64,65,67)/t29-,31?,34-,35-,36-,37-,38?,39-,40-,41-,42-,43-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Alpha-Conotoxin MI
CAS:Alpha-conotoxin MI is a peptide toxin that binds to nicotinic acetylcholine receptors. Alpha-conotoxin MI is a high-purity, recombinant peptide that has been shown to be an activator of nicotinic acetylcholine receptors and inhibit the voltage-gated potassium channel. It may be used as a research tool in cell biology, pharmacology, and neuroscience.Formula:C58H88N22O17SPurity:Min. 95%Molecular weight:1,493.7 g/mol
