CAS 83482-77-3
:Vinmegallate
Description:
Vinmegallate, identified by the CAS number 83482-77-3, is a chemical compound that belongs to the class of gallate esters. It is characterized by its structure, which typically includes a gallate moiety linked to a vinyl group. This compound is often studied for its potential applications in various fields, including pharmaceuticals and materials science, due to its antioxidant properties and ability to interact with biological systems. Vinmegallate may exhibit solubility in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, it may demonstrate biological activity, making it of interest in research related to health and nutrition. As with many chemical substances, safety data and handling precautions are essential when working with vinmegallate to mitigate any potential risks associated with its use. Further studies are often conducted to explore its full range of properties and applications.
Formula:C30H32N2O5
InChI:InChI=1/C30H32N2O5/c1-5-30-12-8-13-31-14-11-22-21-9-6-7-10-23(21)32(26(22)28(30)31)20(17-30)18-37-29(33)19-15-24(34-2)27(36-4)25(16-19)35-3/h6-10,12,15-17,28H,5,11,13-14,18H2,1-4H3/t28-,30+/m1/s1
Synonyms:- Vinmegallate [INN]
- 17,18-Didehydro-3alpha,16alpha-eburnamenine-14-methanol 3,4,5-trimethoxybenzoate (ester)
- Unii-Q50Mb6G17M
- (3Alpha,16Alpha)-17,18-Didehydroeburnamenin-14-Ylmethyl 3,4,5-Trimethoxybenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
