
CAS 834869-05-5
:Ethyl 3-(hydroxymethyl)imidazo[1,2-a]pyridine-8-carboxylate
Description:
Ethyl 3-(hydroxymethyl)imidazo[1,2-a]pyridine-8-carboxylate is a chemical compound characterized by its imidazo-pyridine structure, which incorporates both a hydroxymethyl group and an ethyl ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the hydroxymethyl group may enhance its reactivity and ability to participate in further chemical transformations. Additionally, the ethyl ester moiety can influence its pharmacokinetic properties, potentially affecting absorption and distribution in biological systems. The compound may be of interest in medicinal chemistry due to its structural features, which could contribute to interactions with biological targets. As with many heterocycles, it may also exhibit unique spectroscopic characteristics, making it identifiable through techniques such as NMR and mass spectrometry. Overall, this compound represents a class of molecules that could have applications in drug development or as intermediates in organic synthesis.
Formula:C11H12N2O3
InChI:InChI=1S/C11H12N2O3/c1-2-16-11(15)9-4-3-5-13-8(7-14)6-12-10(9)13/h3-6,14H,2,7H2,1H3
InChI key:InChIKey=MQFMQOVVLHSZLR-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=2N(C(CO)=CN2)C=CC1
Synonyms:- Ethyl 3-(hydroxymethyl)imidazo[1,2-a]pyridine-8-carboxylate
- Imidazo[1,2-a]pyridine-8-carboxylic acid, 3-(hydroxymethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.