
CAS 834884-07-0
:3-Fluoro-2-quinolinecarboxylic acid
Description:
3-Fluoro-2-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a carboxylic acid functional group (-COOH) at the 2-position and a fluorine atom at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its fluorine substitution can influence its reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The compound may participate in various chemical reactions, including nucleophilic substitutions and acid-base reactions, due to the functional groups present. Additionally, it may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 3-Fluoro-2-quinolinecarboxylic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C10H6FNO2
InChI:InChI=1S/C10H6FNO2/c11-7-5-6-3-1-2-4-8(6)12-9(7)10(13)14/h1-5H,(H,13,14)
InChI key:InChIKey=GPOCCEKHGSAOAJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=NC2=C(C=C1F)C=CC=C2
Synonyms:- 2-Quinolinecarboxylic acid, 3-fluoro-
- 3-Fluoro-2-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.