CAS 834884-74-1

4-thiophen-3-ylaniline

Description:

4-Thiophen-3-ylaniline, with the CAS number 834884-74-1, is an organic compound characterized by the presence of both an aniline group and a thiophene ring in its structure. This compound typically exhibits properties associated with both aromatic amines and heterocyclic compounds. It is likely to be a solid at room temperature, with a relatively high melting point due to the presence of strong intermolecular interactions, such as hydrogen bonding and π-π stacking between the aromatic systems. The thiophene ring contributes to its electronic properties, potentially making it useful in organic electronics or as a building block in the synthesis of more complex molecules. Additionally, the compound may exhibit moderate solubility in organic solvents, while its solubility in water could be limited due to the hydrophobic nature of the thiophene moiety. As with many aromatic amines, it may also possess biological activity, which could be of interest in pharmaceutical research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity associated with amine groups.

Formula: C₁₀H₉NS

InChI: InChI=1/C10H9NS/c11-10-3-1-8(2-4-10)9-5-6-12-7-9/h1-7H,11H2

SMILES: c1cc(ccc1c1ccsc1)N

Synonyms:

• 4-(3-Thienyl)aniline
• Benzenamine, 4-(3-thienyl)-

4-(3-Thiophenyl) Aniline

CAS: 834884-74-1

Formula: C₁₀H₉NS

Molecular weight: 175.25

Ref: 4Z-A-248076

4-(Thiophen-3-yl)aniline

CAS: 834884-74-1

4-(Thiophen-3-yl)aniline

Purity: 95%

Molecular weight: 175.25g/mol

Ref: 54-OR963398

4-Thiophen-3-yl-phenylamine

CAS: 834884-74-1

Formula: C₁₀H₉NS

Purity: 98%

Color and Shape: Solid

Molecular weight: 175.25

Ref: 10-F032200

4-(Thiophen-3-yl)aniline

CAS: 834884-74-1

4-(Thiophen-3-yl)aniline is a ligand that can bind to copper, nickel and cobalt ions. It has an octahedral geometry (point symmetry). The frequency of the ligand is determined by the overpotential during cyclic voltammetry. 4-(Thiophen-3-yl)aniline has been shown to be an effective catalyst for electrochemical reactions, such as electrocatalysis of acetonitrile oxidation. The catalytic rate is determined by proton transfer through a phenyl substituent on the ligand.

Formula: C₁₀H₉NS

Purity: Min. 95%

Molecular weight: 175.25 g/mol

Ref: 3D-JIB88474