CAS 834884-80-9

Benzonitrile, 3-(6-formyl-2-pyridinyl)-

Description:

Benzonitrile, 3-(6-formyl-2-pyridinyl)-, also known by its CAS number 834884-80-9, is an organic compound characterized by the presence of a benzonitrile moiety and a pyridine ring with a formyl group at the 6-position. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but has limited solubility in water due to its hydrophobic nature. The presence of the nitrile group (-C≡N) contributes to its polar characteristics, while the formyl group (-CHO) can participate in various chemical reactions, including condensation and oxidation. The compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its structural features allow for potential interactions in various chemical environments, and it can serve as a building block for synthesizing more complex molecules. As with many organic compounds, handling should be done with care, considering potential toxicity and reactivity.

Formula: C₁₃H₈N₂O

InChI: InChI=1S/C13H8N2O/c14-8-10-3-1-4-11(7-10)13-6-2-5-12(9-16)15-13/h1-7,9H

InChI key: InChIKey=SBBBRGAVNLQEHG-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C(C=CC1)C=2N=C(C=O)C=CC2

Synonyms:

• 3-(6-Formylpyridin-2-yl)benzonitrile
• Benzonitrile, 3-(6-formyl-2-pyridinyl)-