CAS 834884-85-4
:6-[4-(Methylthio)phenyl]-2-pyridinecarboxaldehyde
Description:
6-[4-(Methylthio)phenyl]-2-pyridinecarboxaldehyde is an organic compound characterized by its complex structure, which includes a pyridine ring and an aldehyde functional group. The presence of the methylthio group enhances its chemical reactivity and solubility in organic solvents. This compound typically exhibits a yellow to brown color and has a distinct aromatic odor. It is soluble in polar organic solvents like ethanol and dimethyl sulfoxide, while being less soluble in non-polar solvents. The compound's molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and drug development. Its reactivity can be attributed to the aldehyde group, which can participate in various chemical reactions, including condensation and nucleophilic addition. Additionally, the methylthio group can influence the compound's electronic properties and steric hindrance, affecting its overall reactivity and interaction with other molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C13H11NOS
InChI:InChI=1S/C13H11NOS/c1-16-12-7-5-10(6-8-12)13-4-2-3-11(9-15)14-13/h2-9H,1H3
InChI key:InChIKey=PBHUZBQNKVILJP-UHFFFAOYSA-N
SMILES:C(=O)C1=NC(=CC=C1)C2=CC=C(SC)C=C2
Synonyms:- 6-[4-(Methylthio)phenyl]-2-pyridinecarboxaldehyde
- 2-Pyridinecarboxaldehyde, 6-[4-(methylthio)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
