CAS 834885-06-2
:4-(4-fluorophenyl)thiazol-2-ol
Description:
4-(4-Fluorophenyl)thiazol-2-ol is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a fluorophenyl group at the 4-position of the thiazole enhances its chemical properties, potentially influencing its reactivity and biological activity. This compound typically exhibits moderate to high solubility in organic solvents, and its polar nature may allow for interactions with various biological targets. The hydroxyl group (-OH) at the 2-position contributes to its potential as a ligand in coordination chemistry and may also play a role in hydrogen bonding interactions. Due to its structural features, 4-(4-fluorophenyl)thiazol-2-ol may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its specific applications and biological activities would depend on further studies, including its mechanism of action and efficacy in relevant biological systems.
Formula:C9H6FNOS
InChI:InChI=1/C9H6FNOS/c10-7-3-1-6(2-4-7)8-5-13-9(12)11-8/h1-5H,(H,11,12)
SMILES:c1cc(ccc1c1csc(n1)O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
