CAS 834885-08-4
:2-Hydroxy-4,6-dipropoxybenzaldehyde
Description:
2-Hydroxy-4,6-dipropoxybenzaldehyde, with the CAS number 834885-08-4, is an organic compound characterized by its aromatic structure featuring a benzaldehyde functional group. This compound contains two propoxy groups and a hydroxyl group attached to the benzene ring, which influences its chemical reactivity and solubility. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, while the propoxy groups enhance its hydrophobic characteristics. This compound may exhibit properties such as moderate volatility and solubility in organic solvents, making it useful in various chemical applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Its structural features suggest potential antioxidant or antimicrobial activities, although specific biological properties would require further investigation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H18O4
InChI:InChI=1S/C13H18O4/c1-3-5-16-10-7-12(15)11(9-14)13(8-10)17-6-4-2/h7-9,15H,3-6H2,1-2H3
InChI key:InChIKey=AGEJIFIPSQCTCL-UHFFFAOYSA-N
SMILES:C(=O)C1=C(OCCC)C=C(OCCC)C=C1O
Synonyms:- 2-Hydroxy-4,6-Dipropoxybenzaldehyde
- Benzaldehyde, 2-hydroxy-4,6-dipropoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
