CAS 834907-52-7

3-Chloro-5-ethoxy-4-(phenylmethoxy)benzaldehyde

Description:

3-Chloro-5-ethoxy-4-(phenylmethoxy)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. The presence of a chloro substituent at the 3-position and an ethoxy group at the 5-position on the benzene ring contributes to its chemical reactivity and solubility properties. The phenylmethoxy group at the 4-position enhances its potential for various chemical interactions, making it a versatile compound in synthetic organic chemistry. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic rings and polar functional groups, influencing its solubility in organic solvents. Additionally, the presence of the aldehyde functional group suggests that it may participate in nucleophilic addition reactions, while the chloro and ethoxy groups can serve as sites for further substitution reactions. Overall, 3-Chloro-5-ethoxy-4-(phenylmethoxy)benzaldehyde is a compound of interest for applications in pharmaceuticals, agrochemicals, and materials science, where its unique structural features can be exploited for various synthetic pathways.

Formula: C₁₆H₁₅ClO₃

InChI: InChI=1S/C16H15ClO3/c1-2-19-15-9-13(10-18)8-14(17)16(15)20-11-12-6-4-3-5-7-12/h3-10H,2,11H2,1H3

InChI key: InChIKey=KEQQCEDQJFZMAK-UHFFFAOYSA-N

SMILES: O(CC)C1=C(OCC2=CC=CC=C2)C(Cl)=CC(C=O)=C1

Synonyms:

• 3-Chloro-5-ethoxy-4-(phenylmethoxy)benzaldehyde
• Benzaldehyde, 3-chloro-5-ethoxy-4-(phenylmethoxy)-