CAS 834907-53-8
:2,3-Dibromo-5-ethoxy-4-methoxybenzaldehyde
Description:
2,3-Dibromo-5-ethoxy-4-methoxybenzaldehyde is an organic compound characterized by its complex aromatic structure, which includes bromine substituents and functional groups such as an aldehyde, an ethoxy group, and a methoxy group. The presence of the aldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, including oxidation and condensation. The bromine atoms enhance the compound's reactivity and can influence its physical properties, such as solubility and boiling point. The ethoxy and methoxy groups contribute to the compound's overall polarity and can affect its interaction with other molecules. Typically, compounds like this may exhibit moderate to high stability under standard conditions but may be sensitive to light or heat. Additionally, the presence of multiple substituents can lead to interesting electronic effects, potentially making this compound useful in synthetic organic chemistry or as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C10H10Br2O3
InChI:InChI=1S/C10H10Br2O3/c1-3-15-7-4-6(5-13)8(11)9(12)10(7)14-2/h4-5H,3H2,1-2H3
InChI key:InChIKey=VPLFFHKLSAPZNC-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OC)C(Br)=C(Br)C(C=O)=C1
Synonyms:- 2,3-Dibromo-5-ethoxy-4-methoxybenzaldehyde
- Benzaldehyde, 2,3-dibromo-5-ethoxy-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.