CAS 834913-91-6

5-[(4-Ethylphenoxy)methyl]-2-furancarboxylic acid hydrazide

Description:

5-[(4-Ethylphenoxy)methyl]-2-furancarboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a furancarboxylic acid moiety and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and aromatic ethers, potentially influencing its solubility, reactivity, and biological activity. The presence of the ethylphenoxy group may enhance lipophilicity, allowing for better membrane permeability in biological systems. Additionally, the furancarboxylic acid component can participate in various chemical reactions, such as esterification or amidation, making it versatile for synthetic applications. The hydrazide functionality may also confer specific reactivity, particularly in the formation of hydrazones or in coordination with metal ions. Overall, this compound's characteristics suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific biological or chemical properties would require empirical investigation.

Formula: C₁₄H₁₆N₂O₃

InChI: InChI=1S/C14H16N2O3/c1-2-10-3-5-11(6-4-10)18-9-12-7-8-13(19-12)14(17)16-15/h3-8H,2,9,15H2,1H3,(H,16,17)

InChI key: InChIKey=LPFQHZSZHGEGMF-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(CC)C=C1)C=2OC(C(NN)=O)=CC2

Synonyms:

• 5-[(4-Ethylphenoxy)methyl]-2-furancarboxylic acid hydrazide
• 2-Furancarboxylic acid, 5-[(4-ethylphenoxy)methyl]-, hydrazide