CAS 834913-94-9
:3-[(4-Chloro-3-methylphenoxy)methyl]-4-methoxybenzaldehyde
Description:
3-[(4-Chloro-3-methylphenoxy)methyl]-4-methoxybenzaldehyde, with the CAS number 834913-94-9, is an organic compound characterized by its complex structure, which includes a benzaldehyde functional group and ether linkages. This compound features a chloro-substituted aromatic ring, contributing to its potential biological activity and reactivity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its electronic properties. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific arrangement of substituents can affect the compound's physical properties, such as melting point, boiling point, and solubility, as well as its chemical reactivity. Additionally, the presence of halogen atoms often imparts unique characteristics, such as increased lipophilicity or altered metabolic pathways in biological systems. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical applications.
Formula:C16H15ClO3
InChI:InChI=1S/C16H15ClO3/c1-11-7-14(4-5-15(11)17)20-10-13-8-12(9-18)3-6-16(13)19-2/h3-9H,10H2,1-2H3
InChI key:InChIKey=RPEKEFDWEPTYRE-UHFFFAOYSA-N
SMILES:C(OC1=CC(C)=C(Cl)C=C1)C2=C(OC)C=CC(C=O)=C2
Synonyms:- 3-[(4-Chloro-3-methylphenoxy)methyl]-4-methoxybenzaldehyde
- Benzaldehyde, 3-[(4-chloro-3-methylphenoxy)methyl]-4-methoxy-
- 3-(((4-CHLORO-3-METHYLPHENYL)OXY)METHYL)-4-(METHYLOXY)BENZALDEHYDE
- STK298874
- ART-CHEM-BB B001180
- AK-968/37166307
- ZINC00335395
- 3-(4-CHLORO-3-METHYL-PHENOXYMETHYL)-4-METHOXY-BENZALDEHYDE
- AKOS B001180
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.