CAS 835-08-5

[(4-chloronaphthalen-1-yl)oxy]acetate

Description:

[(4-chloronaphthalen-1-yl)oxy]acetate, with the CAS number 835-08-5, is an organic compound characterized by its structure, which includes a naphthalene ring substituted with a chlorine atom and an acetate functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively low reactivity under standard conditions. The presence of the chlorine atom introduces electronegativity, which can influence the compound's reactivity and solubility in various solvents. It is likely to be a solid at room temperature, with potential applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical reactions. The compound's behavior in chemical reactions may be influenced by the electron-withdrawing nature of the chlorine substituent, affecting nucleophilic attack and other reaction mechanisms. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, [(4-chloronaphthalen-1-yl)oxy]acetate is a notable compound in the realm of organic chemistry.

Formula: C₁₂H₈ClO₃

InChI: InChI=1/C12H9ClO3/c13-10-5-6-11(16-7-12(14)15)9-4-2-1-3-8(9)10/h1-6H,7H2,(H,14,15)/p-1

SMILES: c1ccc2c(c1)c(ccc2OCC(=O)[O-])Cl

2-[(4-Chloronaphthalen-1-yl)oxy]acetic acid

CAS: 835-08-5

Versatile small molecule scaffold

Formula: C₁₂H₉ClO₃

Purity: Min. 95%

Molecular weight: 236.65 g/mol

Ref: 3D-AAA83508