CAS 835-11-0
:2,2′-Dihydroxybenzophenone
Description:
2,2′-Dihydroxybenzophenone, also known as BP-2, is an organic compound characterized by its structure, which features two hydroxyl groups attached to a benzophenone framework. This compound is typically a white to pale yellow solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. It is primarily used as a UV filter in various cosmetic and personal care products, providing protection against harmful ultraviolet radiation. Additionally, 2,2′-Dihydroxybenzophenone exhibits antioxidant properties, which can help stabilize formulations and prevent degradation of active ingredients. The compound has a melting point that varies depending on purity and specific conditions, and it is known for its ability to absorb UV light, making it valuable in applications such as plastics, coatings, and sunscreens. However, it is important to note that there are ongoing discussions regarding the environmental and health impacts of certain benzophenone derivatives, leading to regulatory scrutiny in some regions.
Formula:C13H10O3
InChI:InChI=1S/C13H10O3/c14-11-7-3-1-5-9(11)13(16)10-6-2-4-8-12(10)15/h1-8,14-15H
InChI key:InChIKey=YIYBRXKMQFDHSM-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(O)C=CC=C1)C2=C(O)C=CC=C2
Synonyms:- 2-(2-Hydroxybenzoyl)phenol
- Benzophenone, 2,2′-dihydroxy-
- Bis(2-Hydroxyphenyl)Methanone
- Bis(2-hydroxyphenyl) ketone
- Methanone, bis(2-hydroxyphenyl)-
- 2,2′-Dihydroxybenzophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,2'-Dihydroxybenzophenone
CAS:Formula:C13H10O3Purity:>99.0%(GC)Color and Shape:Light yellow to Yellow to Green powder to crystalMolecular weight:214.222,2-Dihydroxybenzophenone
CAS:Formula:C13H10O3Purity:97%Color and Shape:SolidMolecular weight:214.2167Bis(2-hydroxyphenyl)methanone
CAS:Bis(2-hydroxyphenyl)methanonePurity:99%Molecular weight:214.22g/molbis(2-hydroxyphenyl)methanone
CAS:Formula:C13H10O3Purity:97%Color and Shape:SolidMolecular weight:214.222,2'-Dihydroxybenzophenone
CAS:2,2'-Dihydroxybenzophenone is a light-absorbing compound that belongs to the class of dibenzophenones. It has been shown to have cancer-cell inhibitory effects and its anti-tumor effects are due to its ability to inhibit DNA synthesis in tumor cells. 2,2'-Dihydroxybenzophenone has been shown to bind with proteins through hydrogen bonding interactions at the carbonyl group and the hydroxy group. It also has a strong absorption band in the UV region, which makes it useful for UV curing of polymers. This compound can be used as an antioxidant in food products because it does not react with other molecules.
Formula:C13H10O3Purity:Min. 95%Color and Shape:SolidMolecular weight:214.22 g/mol




