CymitQuimica logo

CAS 835-40-5

:

3-(2-Methyl-2-nitropropyl)-1H-indole

Description:
3-(2-Methyl-2-nitropropyl)-1H-indole, with the CAS number 835-40-5, is an organic compound that belongs to the indole family, characterized by its bicyclic structure comprising a benzene ring fused to a pyrrole ring. This compound features a nitro group and a branched alkyl chain, which contribute to its unique chemical properties. Typically, indole derivatives exhibit interesting biological activities, including potential applications in pharmaceuticals and agrochemicals. The presence of the nitro group can influence the compound's reactivity, making it a candidate for various chemical reactions, such as nucleophilic substitutions or reductions. Additionally, the branched alkyl chain may affect the solubility and stability of the compound in different solvents. While specific physical properties such as melting point, boiling point, and solubility can vary, they are essential for understanding the compound's behavior in various chemical environments. Overall, 3-(2-Methyl-2-nitropropyl)-1H-indole represents a significant structure in organic chemistry with potential applications in medicinal chemistry and material science.
Formula:C12H14N2O2
InChI:InChI=1S/C12H14N2O2/c1-12(2,14(15)16)7-9-8-13-11-6-4-3-5-10(9)11/h3-6,8,13H,7H2,1-2H3
InChI key:InChIKey=OCYGHQRIKVNSLX-UHFFFAOYSA-N
SMILES:C(C(N(=O)=O)(C)C)C=1C=2C(NC1)=CC=CC2
Synonyms:
  • 1H-Indole, 3-(2-methyl-2-nitropropyl)-
  • 3-(2-Methyl-2-Nitropropyl)Indole
  • Indole, 3-(2-methyl-2-nitropropyl)-
  • 3-(2-Methyl-2-nitropropyl)-1H-indole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.