CAS 835-58-5

Trifluoromethylphthalicacid; 95%

Description:

Trifluoromethylphthalic acid, with the CAS number 835-58-5, is a chemical compound characterized by the presence of a trifluoromethyl group (-CF3) attached to a phthalic acid structure. This compound typically appears as a white to off-white solid and is known for its high stability and resistance to thermal degradation. The trifluoromethyl group imparts unique electronic properties, enhancing the compound's lipophilicity and influencing its reactivity. Trifluoromethylphthalic acid is often utilized in organic synthesis, particularly in the development of fluorinated materials and pharmaceuticals. Its acidic properties allow it to participate in various chemical reactions, including esterification and amidation. Additionally, due to the presence of fluorine atoms, it exhibits distinct characteristics in terms of solubility and volatility compared to non-fluorinated analogs. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate personal protective equipment should be used.

Formula: C₉H₅F₃O₄

InChI: InChI=1/C9H5F3O4/c10-9(11,12)4-1-2-5(7(13)14)6(3-4)8(15)16/h1-3H,(H,13,14)(H,15,16)

SMILES: c1cc(c(cc1C(F)(F)F)C(=O)O)C(=O)O

Synonyms:

• 4-(Trifluoromethyl)phthalic acid
• 4-(Trifluoromethyl)Benzene-1,2-Dicarboxylic Acid

4-(Trifluoromethyl)phthalic acid

CAS: 835-58-5

Formula: C₉H₅F₃O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 234.1288

Ref: IN-DA003655

4-(Trifluoromethyl)phthalic acid

CAS: 835-58-5

4-(Trifluoromethyl)phthalic acid

Purity: 98%

Molecular weight: 234.129g/mol

Ref: 54-PC103939

4-(Trifluoromethyl)phthalic acid

CAS: 835-58-5

Formula: C₉H₅F₃O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 234.13

Ref: 10-F008636