CAS 83503-21-3

5-(3-hydroxypropyl)-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-(3-Hydroxypropyl)-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 83503-21-3, is a chemical compound that belongs to the class of triazoles, which are five-membered heterocyclic compounds containing three nitrogen atoms. This particular triazole derivative features a phenyl group and a hydroxypropyl substituent, contributing to its unique chemical properties. The presence of the thione functional group (a sulfur atom double-bonded to a carbon atom) indicates potential reactivity, particularly in nucleophilic substitution reactions. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly for its potential as an antimicrobial or antifungal agent. Its solubility, stability, and reactivity can be influenced by the hydroxypropyl group, which may enhance its interaction with biological targets. Overall, this compound's structural features suggest a diverse range of applications in medicinal chemistry and material science, although specific characteristics such as melting point, boiling point, and spectral data would require empirical determination.

Formula: C₁₁H₁₃N₃OS

InChI: InChI=1/C11H13N3OS/c15-8-4-7-10-12-13-11(16)14(10)9-5-2-1-3-6-9/h1-3,5-6,15H,4,7-8H2,(H,13,16)

SMILES: c1ccc(cc1)n1c(CCCO)nnc1S

Synonyms:

• 3-(4-Phenyl-5-sulfanyl-4H-1,2,4-triazol-3-yl)propan-1-ol
• 4H-1,2,4-Triazole-3-propanol, 5-mercapto-4-phenyl-