CAS 83515-26-8

6-methyl-2,5-dihydro-3H-[1,2,4]triazino[5,6-b]indole-3-thione

Description:

6-Methyl-2,5-dihydro-3H-[1,2,4]triazino[5,6-b]indole-3-thione is a heterocyclic compound characterized by its complex structure, which includes a triazine ring fused to an indole moiety. This compound features a methyl group at the 6-position and a thione functional group, which contributes to its chemical reactivity and potential biological activity. The presence of the thione group suggests that it may participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. The compound's unique structure may impart specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and industry. Overall, 6-methyl-2,5-dihydro-3H-[1,2,4]triazino[5,6-b]indole-3-thione represents a class of compounds that may exhibit diverse biological activities, warranting further investigation into its potential uses.

Formula: C₁₀H₈N₄S

InChI: InChI=1/C10H8N4S/c1-5-3-2-4-6-7(5)11-9-8(6)13-14-10(15)12-9/h2-4H,1H3,(H2,11,12,14,15)

SMILES: Cc1cccc2c1[nH]c1c2nnc(n1)S

Synonyms:

• 5H-1,2,4-triazino[5,6-b]indole-3-thiol, 6-methyl-
• 8-Methyl-3,9-dihydro-1,3,4,9-tetraaza-fluorene-2-thione

6-methyl-5H-[1,2,4]triazino[5,6-b]indole-3-thiol

CAS: 83515-26-8

Purity: 95.0%

Molecular weight: 216.046967256

Ref: 10-F314918