CAS 83521-65-7

2-(4-Bromophenyl)-1,3-dithiolane

Description:

2-(4-Bromophenyl)-1,3-dithiolane is an organic compound characterized by its dithiolane ring structure, which consists of a five-membered ring containing two sulfur atoms and three carbon atoms. The presence of a 4-bromophenyl group enhances its chemical reactivity and influences its physical properties. This compound typically exhibits a moderate level of solubility in organic solvents due to the hydrophobic nature of the aromatic bromophenyl substituent. It may display interesting electronic properties owing to the bromine atom, which can act as a substituent that affects the electron density of the aromatic ring. The dithiolane moiety can participate in various chemical reactions, including nucleophilic substitutions and redox reactions, making it a valuable intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, although specific biological properties would require further investigation. Safety data should be consulted, as the presence of bromine can pose health risks, and appropriate handling procedures should be followed in laboratory settings.

Formula: C₉H₉BrS₂

InChI: InChI=1S/C9H9BrS2/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-4,9H,5-6H2

InChI key: InChIKey=ISMCODXVTQSEGF-UHFFFAOYSA-N

SMILES: BrC1=CC=C(C=C1)C2SCCS2

Synonyms:

• 1,3-Dithiolane, 2-(4-bromophenyl)-
• 2-(p-Bromophenyl)-1,3-Dithiolane
• 2-(4-Bromophenyl)-1,3-dithiolane