CAS 83522-13-8

2-(3,4-dichlorophenyl)-1,3-thiazolidine

Description:

2-(3,4-Dichlorophenyl)-1,3-thiazolidine is a chemical compound characterized by its thiazolidine ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of the 3,4-dichlorophenyl group indicates that the compound has two chlorine substituents on a phenyl ring, which can significantly influence its chemical properties, including its reactivity and biological activity. This compound may exhibit various pharmacological effects due to its structural features, making it of interest in medicinal chemistry. Thiazolidines are known for their potential applications in drug development, particularly in the treatment of metabolic disorders. The compound's solubility, stability, and reactivity can vary based on the substituents and the overall molecular structure. Additionally, the presence of halogen atoms like chlorine can enhance lipophilicity, affecting the compound's interaction with biological systems. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential toxicity associated with chlorinated compounds.

Formula: C₉H₉Cl₂NS

InChI: InChI=1/C9H9Cl2NS/c10-7-2-1-6(5-8(7)11)9-12-3-4-13-9/h1-2,5,9,12H,3-4H2