CAS 83527-99-5
:6-amino-3,4-benzocoumarin
Description:
6-Amino-3,4-benzocoumarin is a chemical compound characterized by its unique structure, which combines a benzene ring with a coumarin moiety. This compound features an amino group at the 6-position of the benzocoumarin structure, which can influence its reactivity and solubility. Typically, benzocoumarins exhibit fluorescence properties, making them of interest in various applications, including biological imaging and as potential fluorescent probes. The presence of the amino group can enhance its interaction with biological systems, potentially leading to applications in medicinal chemistry. Additionally, the compound may exhibit various biological activities, such as antimicrobial or anticancer properties, although specific activities would depend on further empirical studies. Its solubility and stability in different solvents can vary, which is crucial for its application in laboratory settings. Overall, 6-amino-3,4-benzocoumarin represents a versatile compound with potential utility in both research and industrial applications.
Formula:C13H9NO2
InChI:InChI=1/C13H9NO2/c14-8-5-6-12-11(7-8)9-3-1-2-4-10(9)13(15)16-12/h1-7H,14H2
SMILES:c1ccc2c(c1)c1cc(ccc1oc2=O)N
Synonyms:- 2-amino-6H-benzo[c]chromen-6-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.