CAS 83529-62-8
:2-(3,4-dihydroxyphenyl)ethyl 3-O-(6-deoxy-alpha-L-mannopyranosyl)-4-O-[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-beta-D-glucopyranoside
Description:
The chemical substance known as "2-(3,4-dihydroxyphenyl)ethyl 3-O-(6-deoxy-alpha-L-mannopyranosyl)-4-O-[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-beta-D-glucopyranoside," with the CAS number 83529-62-8, is a complex glycoside characterized by its intricate structure that includes multiple functional groups. This compound features a phenolic moiety, which contributes to its potential antioxidant properties, and a glycosidic linkage that enhances its solubility and bioavailability. The presence of deoxy sugars suggests a role in biological activity, possibly influencing interactions with biological membranes or receptors. Its structure indicates potential applications in pharmaceuticals or nutraceuticals, particularly in the context of anti-inflammatory or anticancer research. The compound's stability, solubility, and reactivity can be influenced by the presence of hydroxyl groups and the conjugated enoyl moiety, which may also affect its biological activity. Overall, this substance exemplifies the complexity and diversity of natural product chemistry, with implications for health and disease management.
Formula:C30H38O15
InChI:InChI=1/C30H38O15/c1-14-23(36)24(37)25(38)30(42-14)45-28-26(39)29(41-10-9-16-3-6-17(32)19(34)11-16)43-21(13-31)27(28)44-22(35)8-5-15-4-7-18(33)20(12-15)40-2/h3-8,11-12,14,21,23-34,36-39H,9-10,13H2,1-2H3/b8-5+/t14-,21+,23-,24+,25+,26+,27+,28+,29+,30-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Leucosceptoside A
CAS:Leucosceptoside A is a compound isolated from the stem bark of Oroxylum indicum, with anti-hyperglycemic and anti-hypertensive activities.Formula:C30H38O15Purity:99.78%Color and Shape:SolidMolecular weight:638.61Leucosceptoside A
CAS:Leucosceptoside A is a phenylethanoid glycoside, which is a type of natural compound that exhibits significant bioactivity. It is primarily sourced from various plants within the Plantago genus. These plants are well-regarded for their medicinal properties and have been the focus of numerous phytochemical studies.Formula:C30H38O15Purity:Min. 95%Color and Shape:PowderMolecular weight:638.61 g/mol





