
CAS 83540-11-8
:1,4-Dioxa-8-azaspiro[4.5]decane-2-methanol
Description:
1,4-Dioxa-8-azaspiro[4.5]decane-2-methanol, with the CAS number 83540-11-8, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both a dioxane and an azaspiro framework. This compound features a methanol group, contributing to its potential solubility in polar solvents. The presence of the dioxane ring suggests that it may exhibit properties typical of ethers, such as moderate polarity and potential reactivity in nucleophilic substitution reactions. The azaspiro component introduces nitrogen into the structure, which can influence its basicity and potential interactions with biological systems. Additionally, the compound may exhibit interesting conformational properties due to the spiro arrangement, which can affect its reactivity and interaction with other molecules. While specific applications or biological activities may vary, compounds with similar structures are often investigated for their potential in medicinal chemistry and materials science. Overall, 1,4-Dioxa-8-azaspiro[4.5]decane-2-methanol represents a complex and intriguing chemical entity worthy of further study.
Formula:C8H15NO3
InChI:InChI=1S/C8H15NO3/c10-5-7-6-11-8(12-7)1-3-9-4-2-8/h7,9-10H,1-6H2
InChI key:InChIKey=NRURZZCTEVOWQT-UHFFFAOYSA-N
SMILES:C(O)C1OC2(OC1)CCNCC2
Synonyms:- 1,4-Dioxa-8-azaspiro[4.5]decane-2-methanol
- 1,4-Dioxa-8-azaspiro[4.5]decan-2-ylmethanol
- [1,4-Dioxa-8-azaspiro[4.5]decan-2-yl]methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.