
CAS 83548-62-3
:4-Chloro-5-phenyl-2-(phenylmethyl)thieno[2,3-d]pyrimidine
Description:
4-Chloro-5-phenyl-2-(phenylmethyl)thieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes a thieno[2,3-d]pyrimidine core. This compound features a chloro substituent at the 4-position and a phenyl group at the 5-position, along with a phenylmethyl group at the 2-position. The presence of the thieno and pyrimidine rings contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential interactions with biological targets, which could lead to applications in pharmaceuticals, particularly in the development of anti-cancer or anti-inflammatory agents. Additionally, the chlorine atom may influence its reactivity and stability, while the phenyl groups can enhance lipophilicity, affecting its pharmacokinetic properties. Overall, this compound represents a class of thienopyrimidines that may have significant implications in drug discovery and development.
Formula:C19H13ClN2S
InChI:InChI=1S/C19H13ClN2S/c20-18-17-15(14-9-5-2-6-10-14)12-23-19(17)22-16(21-18)11-13-7-3-1-4-8-13/h1-10,12H,11H2
InChI key:InChIKey=BNDCXJHCZDJTHK-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CSC2=NC(CC3=CC=CC=C3)=N1)C4=CC=CC=C4
Synonyms:- 2-Benzyl-4-chloro-5-phenylthieno[2,3-d]pyrimidine
- Thieno[2,3-d]pyrimidine, 4-chloro-5-phenyl-2-(phenylmethyl)-
- 4-Chloro-5-phenyl-2-(phenylmethyl)thieno[2,3-d]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
