CAS 83551-03-5

Octahydro-3-hydroxy-3-(hydroxymethyl)-9-methyl-6-methyleneazuleno[4,5-b]furan-2,8(3H,4H)-dione

Description:

Octahydro-3-hydroxy-3-(hydroxymethyl)-9-methyl-6-methyleneazuleno[4,5-b]furan-2,8(3H,4H)-dione, with the CAS number 83551-03-5, is a complex organic compound characterized by its unique bicyclic structure that incorporates both furan and azulene moieties. This compound features multiple functional groups, including hydroxyl and methylene groups, which contribute to its reactivity and potential biological activity. The presence of these functional groups suggests that it may exhibit properties such as solubility in polar solvents and the ability to participate in hydrogen bonding. Additionally, the compound's structural features may influence its stability and interactions with other molecules, making it of interest in various fields, including medicinal chemistry and materials science. Its specific applications and biological activities would depend on further research, particularly in the context of its potential therapeutic uses or as a precursor in synthetic chemistry. Overall, this compound exemplifies the complexity and diversity found in organic chemistry, particularly in the realm of polycyclic compounds.

Formula: C₁₅H₂₀O₅

InChI: InChI=1S/C15H20O5/c1-7-3-4-10-13(20-14(18)15(10,19)6-16)12-8(2)11(17)5-9(7)12/h8-10,12-13,16,19H,1,3-6H2,2H3

InChI key: InChIKey=XJUFXNXZZRHROZ-UHFFFAOYSA-N

SMILES: CC1C2C3C(C(CO)(O)C(=O)O3)CCC(=C)C2CC1=O

Synonyms:

• Octahydro-3-hydroxy-3-(hydroxymethyl)-9-methyl-6-methyleneazuleno[4,5-b]furan-2,8(3H,4H)-dione
• Azuleno[4,5-b]furan-2,8(3H,4H)-dione, octahydro-3-hydroxy-3-(hydroxymethyl)-9-methyl-6-methylene-

11,13-Dihydroxy-3-oxo-10(14)guaien-12,6-olide - Cynara cardunculus (artichoke)

CAS: 83551-03-5

11,13-Dihydroxy-3-oxo-10(14)guaien-12,6-olide is a bioactive compound, which is a phytochemical derived from Cynara cardunculus, commonly known as the artichoke. This compound belongs to a class of organic compounds known as sesquiterpene lactones. It is primarily sourced from the leaves and flower buds of the artichoke plant, which are rich in various polyphenolic and terpenoid components.

Formula: C₁₅H₂₀O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 280.32 g/mol

Ref: 3D-XD170631