CymitQuimica logo

CAS 83558-10-5

:

2-Chloro-N-[4-(3-methoxyphenyl)-2-thiazolyl]acetamide

Description:
2-Chloro-N-[4-(3-methoxyphenyl)-2-thiazolyl]acetamide, with the CAS number 83558-10-5, is a chemical compound characterized by its unique structural features, which include a chloro group, an acetamide moiety, and a thiazole ring substituted with a methoxyphenyl group. This compound typically exhibits properties associated with both its thiazole and aromatic components, such as potential biological activity, including antimicrobial or anticancer properties, although specific activities can vary based on the context of use. The presence of the chloro substituent may influence its reactivity and solubility in various solvents. Additionally, the methoxy group can enhance the lipophilicity of the molecule, potentially affecting its pharmacokinetic properties. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks such as toxicity or environmental hazards. Overall, 2-Chloro-N-[4-(3-methoxyphenyl)-2-thiazolyl]acetamide represents a compound of interest in medicinal chemistry and related fields.
Formula:C12H11ClN2O2S
InChI:InChI=1S/C12H11ClN2O2S/c1-17-9-4-2-3-8(5-9)10-7-18-12(14-10)15-11(16)6-13/h2-5,7H,6H2,1H3,(H,14,15,16)
InChI key:InChIKey=FHLLFUKEQCSCPL-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C1=NC(=CS1)C2=CC(OC)=CC=C2
Synonyms:
  • 2-Chloro-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]acetamide
  • 2-Chloro-N-[4-(3-methoxyphenyl)-2-thiazolyl]acetamide
  • Acetamide, 2-chloro-N-[4-(3-methoxyphenyl)-2-thiazolyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.