CAS 835633-79-9

3-Fluoro-4-[4-(1-methylethyl)-1-piperazinyl]benzenamine

Description:

3-Fluoro-4-[4-(1-methylethyl)-1-piperazinyl]benzenamine, with the CAS number 835633-79-9, is a chemical compound characterized by its aromatic amine structure. It features a fluorine atom at the meta position relative to an amine group on a benzene ring, which contributes to its reactivity and potential biological activity. The presence of a piperazine moiety, substituted with an isopropyl group, enhances its lipophilicity and may influence its pharmacokinetic properties. This compound is likely to exhibit basic properties due to the amine functional group, allowing it to participate in hydrogen bonding and interact with various biological targets. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders or other therapeutic areas. As with many compounds containing nitrogen and fluorine, it may also exhibit unique electronic properties that could be exploited in drug design. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₁₃H₂₀FN₃

InChI: InChI=1S/C13H20FN3/c1-10(2)16-5-7-17(8-6-16)13-4-3-11(15)9-12(13)14/h3-4,9-10H,5-8,15H2,1-2H3

InChI key: InChIKey=NOGFOWCYFNRFJG-UHFFFAOYSA-N

SMILES: FC1=C(C=CC(N)=C1)N2CCN(C(C)C)CC2

Synonyms:

• 3-Fluoro-4-[4-(1-methylethyl)-1-piperazinyl]benzenamine
• 3-Fluoro-4-(4-isopropylpiperazin-1-yl)phenylamine
• 3-Fluoro-4-[4-(propan-2-yl)piperazin-1-yl]aniline
• 3-Fluoro-4-(4-isopropylpiperazin-1-yl)aniline
• Benzenamine, 3-fluoro-4-[4-(1-methylethyl)-1-piperazinyl]-