
CAS 83566-34-1
:3-Amino-2H-1,4-benzoxazin-2-one
Description:
3-Amino-2H-1,4-benzoxazin-2-one is an organic compound characterized by its heterocyclic structure, which includes a benzene ring fused to a 1,4-benzoxazine moiety. This compound features an amino group (-NH2) and a carbonyl group (C=O) within its structure, contributing to its reactivity and potential applications in various fields. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino group. The compound is of interest in medicinal chemistry and agricultural chemistry, often studied for its potential biological activities, including antimicrobial and herbicidal properties. Its unique structure allows for various chemical modifications, which can enhance its efficacy or alter its properties for specific applications. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, 3-Amino-2H-1,4-benzoxazin-2-one represents a versatile compound with significant research potential.
Formula:C8H6N2O2
InChI:InChI=1S/C8H6N2O2/c9-7-8(11)12-6-4-2-1-3-5(6)10-7/h1-4H,(H2,9,10)
InChI key:InChIKey=DALLAVYXVKQOMX-UHFFFAOYSA-N
SMILES:NC1=NC=2C(OC1=O)=CC=CC2
Synonyms:- 2H-1,4-Benzoxazin-2-one, 3-amino-
- 3-Amino-2H-benzo[b][1,4]oxazin-2-one
- 3-Amino-2H-1,4-benzoxazin-2-one
- 3-Amino-1,4-benzoxazin-2-one
- 3-Imino-3,4-dihydro-2H-1,4-benzoxazin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.