
CAS 83585-57-3
:N-Hexyl-1,4,7,10,13,16-hexaoxacyclooctadecane-2-methanamine
Description:
N-Hexyl-1,4,7,10,13,16-hexaoxacyclooctadecane-2-methanamine, with CAS number 83585-57-3, is a synthetic compound characterized by its unique structure, which includes a long hexyl chain and a cyclic arrangement of ether linkages. This compound features six ether (–O–) groups integrated into a cyclic framework, contributing to its potential solubility in various solvents and its ability to form complexes with metal ions. The presence of a methanamine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, enhancing its reactivity and interaction with other chemical species. Its long hydrophobic hexyl chain may impart surfactant-like properties, making it useful in applications such as emulsification or as a surfactant in formulations. Additionally, the compound's structural features may influence its thermal stability and mechanical properties, making it of interest in materials science and chemical engineering. Overall, this compound's unique characteristics position it for potential applications in various fields, including pharmaceuticals, materials science, and nanotechnology.
Formula:C19H39NO6
InChI:InChI=1S/C19H39NO6/c1-2-3-4-5-6-20-17-19-18-25-14-13-23-10-9-21-7-8-22-11-12-24-15-16-26-19/h19-20H,2-18H2,1H3
InChI key:InChIKey=MQOGBZQEKDKLMJ-UHFFFAOYSA-N
SMILES:C(NCCCCCC)C1COCCOCCOCCOCCOCCO1
Synonyms:- N-Hexyl-1,4,7,10,13,16-hexaoxacyclooctadecane-2-methanamine
- 1,4,7,10,13,16-Hexaoxacyclooctadecane-2-methanamine, N-hexyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,4,7,10,13,16-Hexaoxacyclooctadecane-2-methanamine, N-hexyl-
CAS:Formula:C19H39NO6Molecular weight:377.5161
