CAS 83585-61-9
:2-(aminomethyl)-18-crown-6
Description:
2-(Aminomethyl)-18-crown-6 is a synthetic organic compound belonging to the crown ether family, characterized by its ability to selectively bind cations, particularly alkali and alkaline earth metals. Its structure features a crown-like arrangement of ether linkages, specifically containing 18 carbon atoms in a cyclic arrangement, with an amino group (-NH2) attached to one of the carbon atoms. This amino group enhances the compound's solubility in polar solvents and increases its ability to form complexes with metal ions. The presence of the amino group also allows for potential applications in various fields, including ion-selective electrodes, extraction processes, and as a ligand in coordination chemistry. The compound exhibits properties such as good thermal stability and moderate solubility in water and organic solvents. Its unique binding properties make it valuable in analytical chemistry and materials science, where it can be used for the selective extraction and transport of specific ions. Overall, 2-(aminomethyl)-18-crown-6 is a versatile compound with significant implications in both research and industrial applications.
Formula:C13H27NO6
InChI:InChI=1/C13H27NO6/c14-11-13-12-19-8-7-17-4-3-15-1-2-16-5-6-18-9-10-20-13/h13H,1-12,14H2
SMILES:C1COCCOCCOC(CN)COCCOCCO1
Synonyms:- 1-(1,4,7,10,13,16-Hexaoxacyclooctadecan-2-Yl)Methanamine
- 2-Aminomethyl-18-crown-6
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,4,7,10,13,16-Hexaoxacyclooctadecane-2-methanamine
CAS:Formula:C13H27NO6Purity:95%Color and Shape:SolidMolecular weight:293.35662-Aminomethyl-18-crown-6
CAS:Controlled ProductFormula:C13H27NO6Color and Shape:NeatMolecular weight:293.3572-Aminomethyl-18-crown-6
CAS:2-Aminomethyl-18-crown-6 is a crown ether that can be used to transport molecules across membranes. It has been shown to form ionic or nonionic complexes with single-stranded DNA, as well as having bifunctional properties. It can also be used to immobilize organic molecules on surfaces and can be synthesized in the laboratory by reacting an imine with sodium salts. The crown ethers have the ability to solvate hydrophobic molecules and are able to form hydrogen bonds with water. 2-Aminomethyl-18-crown-6 has been shown to have synergistic effects with other drugs, including antibiotics, due to its ability to bind divalent cations such as magnesium and calcium. This molecule has functional groups that are reactive towards nucleophilic attack, which makes it a good candidate for molecular modeling studies of proteins and peptides.br>br> 2-Aminomethyl-18Formula:C13H27NO6Purity:Min. 94.0 Area-%Color and Shape:Clear LiquidMolecular weight:293.36 g/mol


