CAS 835878-82-5
:1-(2,4,6-Trifluorophenyl)-2-propanone
Description:
1-(2,4,6-Trifluorophenyl)-2-propanone, with the CAS number 835878-82-5, is an organic compound characterized by its ketone functional group and a trifluorinated phenyl substituent. This compound features a propanone backbone, where the carbonyl group (C=O) is attached to a propyl chain, and a phenyl ring that is substituted with three fluorine atoms at the 2, 4, and 6 positions. The presence of these electronegative fluorine atoms significantly influences the compound's physical and chemical properties, such as increasing its polarity and potentially enhancing its reactivity. This compound may exhibit unique solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Additionally, the trifluorophenyl group can impart interesting electronic properties, making it a candidate for various applications in pharmaceuticals, agrochemicals, and materials science. Safety data should be consulted for handling and storage, as fluorinated compounds can pose specific health and environmental risks.
Formula:C9H7F3O
InChI:InChI=1S/C9H7F3O/c1-5(13)2-7-8(11)3-6(10)4-9(7)12/h3-4H,2H2,1H3
InChI key:InChIKey=NAKZSJUHEAAUHN-UHFFFAOYSA-N
SMILES:C(C(C)=O)C1=C(F)C=C(F)C=C1F
Synonyms:- 2-Propanone, 1-(2,4,6-trifluorophenyl)-
- 1-(2,4,6-Trifluorophenyl)-2-propanone
- 1-(2,4,6-Trifluorophenyl)propan-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.