CymitQuimica logo

CAS 835916-04-6

:

[(2R)-2-[[(tert-Butoxy)carbonyl]amino]-3-phenylpropyl]carbamic acid benzyl ester

Description:
The chemical substance known as [(2R)-2-[[(tert-Butoxy)carbonyl]amino]-3-phenylpropyl]carbamic acid benzyl ester, with the CAS number 835916-04-6, is a complex organic compound characterized by its structural features that include a carbamic acid moiety and a benzyl ester. This compound typically exhibits properties associated with both amines and esters, making it relevant in medicinal chemistry and organic synthesis. The presence of the tert-butoxycarbonyl (Boc) protecting group suggests that it is likely used in peptide synthesis or as an intermediate in the preparation of more complex molecules. The phenyl group contributes to its hydrophobic character, which can influence solubility and reactivity. Additionally, the stereochemistry indicated by the (2R) configuration implies that the compound has specific spatial arrangements that may affect its biological activity and interactions with other molecules. Overall, this compound's unique structure and functional groups make it a valuable candidate for research in drug development and synthetic chemistry.
Formula:C22H28N2O4
InChI:InChI=1/C22H28N2O4/c1-22(2,3)28-21(26)24-19(14-17-10-6-4-7-11-17)15-23-20(25)27-16-18-12-8-5-9-13-18/h4-13,19H,14-16H2,1-3H3,(H,23,25)(H,24,26)/t19-/m1/s1
SMILES:CC(C)(C)OC(=N[C@H](Cc1ccccc1)CN=C(O)OCc1ccccc1)O
Synonyms:
  • Benzyl tert-butyl [(2R)-3-phenylpropane-1,2-diyl]biscarbamate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.