CAS 835916-78-4
:1-Cyclobutyl-4-phenylpiperazine
Description:
1-Cyclobutyl-4-phenylpiperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring substituted with a cyclobutyl group and a phenyl group. This compound is classified as a piperazine derivative, which often exhibits psychoactive properties and potential applications in medicinal chemistry. The presence of the cyclobutyl moiety can influence the compound's conformational flexibility and steric interactions, while the phenyl group may enhance lipophilicity, affecting its pharmacokinetic profile. Typically, compounds like this are studied for their interactions with various neurotransmitter receptors, particularly in the context of neuropharmacology. The molecular formula and specific stereochemistry can significantly impact its biological activity and therapeutic potential. As with many piperazine derivatives, research may focus on its effects on the central nervous system, making it of interest in the development of new therapeutic agents for psychiatric disorders. Safety and toxicity profiles are also critical considerations in the evaluation of such compounds for potential use in pharmaceuticals.
Formula:C14H20N2
InChI:InChI=1/C14H20N2/c1-2-5-13(6-3-1)15-9-11-16(12-10-15)14-7-4-8-14/h1-3,5-6,14H,4,7-12H2
SMILES:c1ccc(cc1)N1CCN(CC1)C1CCC1
Synonyms:- Piperazine, 1-Cyclobutyl-4-Phenyl-
- 1-Cyclobutyl-4-Phenylpiperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.