CAS 83592-08-9

[4-(3-benzyloxy-3-oxo-propyl)phenyl] 6-(benzyloxycarbonylamino)hexanoate

Description:

The chemical substance known as [4-(3-benzyloxy-3-oxo-propyl)phenyl] 6-(benzyloxycarbonylamino)hexanoate, with the CAS number 83592-08-9, is a complex organic compound characterized by its multi-functional structure. It features a phenyl ring substituted with a benzyloxy group and a propyl chain that includes a ketone functional group, indicating potential reactivity and applications in organic synthesis. The presence of a hexanoate moiety suggests that it may exhibit ester characteristics, which can influence its solubility and reactivity. Additionally, the benzyloxycarbonylamino group indicates that this compound may have biological relevance, possibly serving as a prodrug or a precursor in pharmaceutical applications. Its structural complexity may also impart unique physical properties, such as specific melting and boiling points, as well as solubility in various organic solvents. Overall, this compound's diverse functional groups and structural features make it a subject of interest in both synthetic chemistry and medicinal chemistry research.

Formula: C₃₀H₃₃NO₆

InChI: InChI=1/C30H33NO6/c32-28(35-22-25-10-4-1-5-11-25)20-17-24-15-18-27(19-16-24)37-29(33)14-8-3-9-21-31-30(34)36-23-26-12-6-2-7-13-26/h1-2,4-7,10-13,15-16,18-19H,3,8-9,14,17,20-23H2,(H,31,34)

SMILES: c1ccc(cc1)COC(=O)CCc1ccc(cc1)OC(=O)CCCCCN=C(O)OCc1ccccc1