CAS 83592-10-3

3-(4-(N-Biotinoyl-6-aminocaproyloxy)phenyl)propionic acid

Description:

3-(4-(N-Biotinoyl-6-aminocaproyloxy)phenyl)propionic acid, with the CAS number 83592-10-3, is a bioconjugate compound that combines a phenylpropionic acid moiety with a biotinylated linker. This compound is characterized by its ability to facilitate the attachment of biomolecules to surfaces or other molecules through biotin-streptavidin interactions, which are known for their high affinity and specificity. The presence of the biotin moiety allows for versatile applications in biochemical assays, drug delivery systems, and molecular imaging. The compound typically exhibits solubility in polar solvents, and its structure includes functional groups that may participate in hydrogen bonding and other intermolecular interactions. Additionally, the incorporation of the aminocaproyloxy group enhances its hydrophilicity and may influence its biological activity. Overall, this compound is valuable in research and therapeutic contexts, particularly in the fields of molecular biology and biochemistry.

Formula: C₂₅H₃₅N₃O₆S

InChI: InChI=1/C25H35N3O6S/c29-21(7-4-3-6-20-24-19(16-35-20)27-25(33)28-24)26-15-5-1-2-8-23(32)34-18-12-9-17(10-13-18)11-14-22(30)31/h9-10,12-13,19-20,24H,1-8,11,14-16H2,(H,26,29)(H,30,31)(H2,27,28,33)/t19-,20-,24-/m0/s1

SMILES: C(CCC(=O)Oc1ccc(cc1)CCC(=O)O)CCN=C(CCCC[C@H]1[C@@H]2[C@H](CS1)N=C(N2)O)O

Synonyms:

• 4-[[6-[[5-(Hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl)-1-oxopentyl]amino]-1-oxohexyl]oxy]benzenepropanoic acid