CAS 83592-11-4
:N-Acetyl-L-homoserine
Description:
N-Acetyl-L-homoserine is an amino acid derivative characterized by its acetylated homoserine structure. It is a white to off-white crystalline solid that is soluble in water and polar organic solvents, reflecting its polar functional groups. This compound is often used in biochemical research and has applications in the synthesis of peptides and other bioactive molecules. N-Acetyl-L-homoserine plays a role in various metabolic pathways and can serve as a building block in the synthesis of more complex compounds. Its molecular structure includes an acetyl group attached to the amino acid homoserine, which contributes to its reactivity and interaction with biological systems. The compound is generally stable under standard laboratory conditions but should be handled with care, as with all chemical substances, to avoid potential hazards. Proper storage in a cool, dry place away from incompatible materials is recommended to maintain its integrity.
Formula:C6H11NO4
InChI:InChI=1S/C6H11NO4/c1-4(9)7-5(2-3-8)6(10)11/h5,8H,2-3H2,1H3,(H,7,9)(H,10,11)/t5-/m0/s1
InChI key:InChIKey=HCBFOIPUKYKZJC-YFKPBYRVSA-N
SMILES:[C@H](NC(C)=O)(CCO)C(O)=O
Synonyms:- N-Acetyl-L-homoserine
- (2S)-2-Acetamido-4-hydroxybutanoic acid
- L-Homoserine, N-acetyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.