CymitQuimica logo

CAS 83592-45-4

:

N,N-Dimethyl-6-(methylamino)-2-pyridinemethanamine

Description:
N,N-Dimethyl-6-(methylamino)-2-pyridinemethanamine, with the CAS number 83592-45-4, is a chemical compound that belongs to the class of pyridine derivatives. It features a pyridine ring substituted with both dimethyl and methylamino groups, which contributes to its unique chemical properties. This compound is typically characterized by its basicity due to the presence of the amino groups, which can participate in protonation reactions. It may exhibit solubility in polar solvents, reflecting the influence of its functional groups. The presence of multiple nitrogen atoms can also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the structural configuration may influence its reactivity and interaction with biological systems. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, N,N-Dimethyl-6-(methylamino)-2-pyridinemethanamine is a compound of interest in various chemical research fields.
Formula:C9H15N3
InChI:InChI=1S/C9H15N3/c1-10-9-6-4-5-8(11-9)7-12(2)3/h4-6H,7H2,1-3H3,(H,10,11)
InChI key:InChIKey=LQGGMFICQOXOIS-UHFFFAOYSA-N
SMILES:C(N(C)C)C=1N=C(NC)C=CC1
Synonyms:
  • N,N-Dimethyl-6-(methylamino)-2-pyridinemethanamine
  • 2-Pyridinemethanamine, N,N-dimethyl-6-(methylamino)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.